C20H28N2O3S — CID 33304599
(3S,7aR)-N-[2-(4-tert-butylphenoxy)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 33304599) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is (3S,7aR)-N-[2-(4-tert-butylphenoxy)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-N-[2-(4-tert-butylphenoxy)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 33304599 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (3S,7aR)-N-[2-(4-tert-butylphenoxy)ethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC(C)(C)c1ccc(OCCNC(=O)[C@H]2CS[C@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C20H28N2O3S/c1-19(2,3)14-5-7-15(8-6-14)25-12-11-21-18(24)16-13-26-20(4)10-9-17(23)22(16)20/h5-8,16H,9-13H2,1-4H3,(H,21,24)/t16-,20-/m1/s1 |
| InChIKey | ZJZBVFIBQLLFFE-OXQOHEQNSA-N |
| XLogP | 2.93 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|