C23H26N2O3S — CID 55674554
N-[(4-ethoxyphenyl)-phenylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 55674554) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)-phenylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[(4-ethoxyphenyl)-phenylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 55674554 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | N-[(4-ethoxyphenyl)-phenylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CCOc1ccc(C(NC(=O)C2CSC3(C)CCC(=O)N23)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c1-3-28-18-11-9-17(10-12-18)21(16-7-5-4-6-8-16)24-22(27)19-15-29-23(2)14-13-20(26)25(19)23/h4-12,19,21H,3,13-15H2,1-2H3,(H,24,27) |
| InChIKey | OAYFRQSDHJOXTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |