C23H26N2O2S2 — CID 55453746
7a-methyl-5-oxo-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 55453746) has the molecular formula C23H26N2O2S2 and a molecular weight of 426.61 g/mol. Its IUPAC name is 7a-methyl-5-oxo-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | 7a-methyl-5-oxo-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 55453746 |
| Molecular Formula | C23H26N2O2S2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 7a-methyl-5-oxo-N-[5,6,7,8-tetrahydronaphthalen-2-yl(thiophen-2-yl)methyl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)NC(c1ccc3c(c1)CCCC3)c1cccs1)CS2 |
| InChI | InChI=1S/C23H26N2O2S2/c1-23-11-10-20(26)25(23)18(14-29-23)22(27)24-21(19-7-4-12-28-19)17-9-8-15-5-2-3-6-16(15)13-17/h4,7-9,12-13,18,21H,2-3,5-6,10-11,14H2,1H3,(H,24,27) |
| InChIKey | YXDBWXQWAFYARA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |