C18H21ClN2O2S — CID 100909551
(3S,7aS)-N-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 100909551) has the molecular formula C18H21ClN2O2S and a molecular weight of 364.90 g/mol. Its IUPAC name is (3S,7aS)-N-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aS)-N-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 100909551 |
| Molecular Formula | C18H21ClN2O2S |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | (3S,7aS)-N-[(S)-(4-chlorophenyl)-cyclopropylmethyl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)N[C@H](c1ccc(Cl)cc1)C1CC1)CS2 |
| InChI | InChI=1S/C18H21ClN2O2S/c1-18-9-8-15(22)21(18)14(10-24-18)17(23)20-16(11-2-3-11)12-4-6-13(19)7-5-12/h4-7,11,14,16H,2-3,8-10H2,1H3,(H,20,23)/t14-,16+,18+/m1/s1 |
| InChIKey | XRUKMGSMIZAEBF-HFTRVMKXSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |