C19H24ClN3O2S — CID 25331670
(3S,7aR)-N-(5-chloro-2-piperidin-1-ylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 25331670) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is (3S,7aR)-N-(5-chloro-2-piperidin-1-ylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-N-(5-chloro-2-piperidin-1-ylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 25331670 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (3S,7aR)-N-(5-chloro-2-piperidin-1-ylphenyl)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)Nc1cc(Cl)ccc1N1CCCCC1)CS2 |
| InChI | InChI=1S/C19H24ClN3O2S/c1-19-8-7-17(24)23(19)16(12-26-19)18(25)21-14-11-13(20)5-6-15(14)22-9-3-2-4-10-22/h5-6,11,16H,2-4,7-10,12H2,1H3,(H,21,25)/t16-,19-/m1/s1 |
| InChIKey | ZFOWJXWDAZUSBD-VQIMIIECSA-N |
| XLogP | 3.72 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |