C21H23N3O2S2 — CID 8780782
(3S,7aR)-7a-methyl-5-oxo-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 8780782) has the molecular formula C21H23N3O2S2 and a molecular weight of 413.57 g/mol. Its IUPAC name is (3S,7aR)-7a-methyl-5-oxo-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aR)-7a-methyl-5-oxo-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 8780782 |
| Molecular Formula | C21H23N3O2S2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (3S,7aR)-7a-methyl-5-oxo-N-[4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-yl]-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@@]12CCC(=O)N1[C@@H](C(=O)Nc1nc(-c3ccc4c(c3)CCCC4)cs1)CS2 |
| InChI | InChI=1S/C21H23N3O2S2/c1-21-9-8-18(25)24(21)17(12-28-21)19(26)23-20-22-16(11-27-20)15-7-6-13-4-2-3-5-14(13)10-15/h6-7,10-11,17H,2-5,8-9,12H2,1H3,(H,22,23,26)/t17-,21-/m1/s1 |
| InChIKey | HXHWZNYEGXNYKP-DYESRHJHSA-N |
| XLogP | 4.08 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |