C18H18FN3O3S2 — CID 39964940
(3S,7aS)-N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 39964940) has the molecular formula C18H18FN3O3S2 and a molecular weight of 407.49 g/mol. Its IUPAC name is (3S,7aS)-N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3S,7aS)-N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 39964940 |
| Molecular Formula | C18H18FN3O3S2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | (3S,7aS)-N-[4-(3-fluoro-4-methoxyphenyl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=O)[C@H]3CS[C@@]4(C)CCC(=O)N34)n2)cc1F |
| InChI | InChI=1S/C18H18FN3O3S2/c1-18-6-5-15(23)22(18)13(9-27-18)16(24)21-17-20-12(8-26-17)10-3-4-14(25-2)11(19)7-10/h3-4,7-8,13H,5-6,9H2,1-2H3,(H,20,21,24)/t13-,18+/m1/s1 |
| InChIKey | IBLGVTODGMXQPC-ACJLOTCBSA-N |
| XLogP | 3.35 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |