C15H14BrN3O2S3 — CID 42889168
N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 42889168) has the molecular formula C15H14BrN3O2S3 and a molecular weight of 444.40 g/mol. Its IUPAC name is N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 42889168 |
| Molecular Formula | C15H14BrN3O2S3 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 442.94 |
| IUPAC Name | N-[4-(5-bromothiophen-2-yl)-1,3-thiazol-2-yl]-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | CC12CCC(=O)N1C(C(=O)Nc1nc(-c3ccc(Br)s3)cs1)CS2 |
| InChI | InChI=1S/C15H14BrN3O2S3/c1-15-5-4-12(20)19(15)9(7-23-15)13(21)18-14-17-8(6-22-14)10-2-3-11(16)24-10/h2-3,6,9H,4-5,7H2,1H3,(H,17,18,21) |
| InChIKey | CUDVVTPNDZGBLV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |