C25H24FN5O3S — CID 33325875
N-[2-[[2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 33325875) has the molecular formula C25H24FN5O3S and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[2-[[2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[[2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 33325875 |
| Molecular Formula | C25H24FN5O3S |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[2-[[2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNC(=O)CSc2nnc(-c3ccco3)n2Cc2ccccc2)cc1F |
| InChI | InChI=1S/C25H24FN5O3S/c1-17-9-10-19(14-20(17)26)24(33)28-12-11-27-22(32)16-35-25-30-29-23(21-8-5-13-34-21)31(25)15-18-6-3-2-4-7-18/h2-10,13-14H,11-12,15-16H2,1H3,(H,27,32)(H,28,33) |
| InChIKey | UKTJQZDBYZDKNC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|