C26H29N5O2S — CID 55619386
2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide (PubChem CID 55619386) has the molecular formula C26H29N5O2S and a molecular weight of 475.62 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide.
| Compound Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide |
|---|---|
| PubChem CID | 55619386 |
| Molecular Formula | C26H29N5O2S |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[4-(dimethylamino)phenyl]propyl]acetamide |
| SMILES | CN(C)c1ccc(CCCNC(=O)CSc2nnc(-c3ccco3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H29N5O2S/c1-30(2)22-14-12-20(13-15-22)10-6-16-27-24(32)19-34-26-29-28-25(23-11-7-17-33-23)31(26)18-21-8-4-3-5-9-21/h3-5,7-9,11-15,17H,6,10,16,18-19H2,1-2H3,(H,27,32) |
| InChIKey | LGOPUIIWIVNGRO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|