C25H33N5O2S — CID 55573476
2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide (PubChem CID 55573476) has the molecular formula C25H33N5O2S and a molecular weight of 467.64 g/mol. Its IUPAC name is 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide.
| Compound Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 55573476 |
| Molecular Formula | C25H33N5O2S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 2-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-N-[3-[cyclohexyl(methyl)amino]propyl]acetamide |
| SMILES | CN(CCCNC(=O)CSc1nnc(-c2ccco2)n1Cc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C25H33N5O2S/c1-29(21-12-6-3-7-13-21)16-9-15-26-23(31)19-33-25-28-27-24(22-14-8-17-32-22)30(25)18-20-10-4-2-5-11-20/h2,4-5,8,10-11,14,17,21H,3,6-7,9,12-13,15-16,18-19H2,1H3,(H,26,31) |
| InChIKey | ZBLDKBPQJCCABA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|