C24H29N5O2S2 — CID 33348483
3-[[5-(2-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one (PubChem CID 33348483) has the molecular formula C24H29N5O2S2 and a molecular weight of 483.66 g/mol. Its IUPAC name is 3-[[5-(2-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one.
| Compound Name | 3-[[5-(2-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 33348483 |
| Molecular Formula | C24H29N5O2S2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 3-[[5-(2-ethylanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]-1-[4-(4-methoxyphenyl)piperazin-1-yl]propan-1-one |
| SMILES | CCc1ccccc1Nc1nnc(SCCC(=O)N2CCN(c3ccc(OC)cc3)CC2)s1 |
| InChI | InChI=1S/C24H29N5O2S2/c1-3-18-6-4-5-7-21(18)25-23-26-27-24(33-23)32-17-12-22(30)29-15-13-28(14-16-29)19-8-10-20(31-2)11-9-19/h4-11H,3,12-17H2,1-2H3,(H,25,26) |
| InChIKey | YPCXGWJRNBPYRZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|