C17H21N5O2S2 — CID 35271464
N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-oxo-4-(4-phenylpiperazin-1-yl)butanamide (PubChem CID 35271464) has the molecular formula C17H21N5O2S2 and a molecular weight of 391.52 g/mol. Its IUPAC name is N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-oxo-4-(4-phenylpiperazin-1-yl)butanamide.
| Compound Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-oxo-4-(4-phenylpiperazin-1-yl)butanamide |
|---|---|
| PubChem CID | 35271464 |
| Molecular Formula | C17H21N5O2S2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-oxo-4-(4-phenylpiperazin-1-yl)butanamide |
| SMILES | CSc1nnc(NC(=O)CCC(=O)N2CCN(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C17H21N5O2S2/c1-25-17-20-19-16(26-17)18-14(23)7-8-15(24)22-11-9-21(10-12-22)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,18,19,23) |
| InChIKey | OUHWVVPBVUVDED-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|