C23H31N5O4S2 — CID 95752650
tert-butyl 4-[4-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoyl]-1,4-diazepane-1-carboxylate (PubChem CID 95752650) has the molecular formula C23H31N5O4S2 and a molecular weight of 505.67 g/mol. Its IUPAC name is tert-butyl 4-[4-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoyl]-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 95752650 |
| Molecular Formula | C23H31N5O4S2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.18 |
| IUPAC Name | tert-butyl 4-[4-[(5-benzylsulfanyl-1,3,4-thiadiazol-2-yl)amino]-4-oxobutanoyl]-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)CCC(=O)Nc2nnc(SCc3ccccc3)s2)CC1 |
| InChI | InChI=1S/C23H31N5O4S2/c1-23(2,3)32-22(31)28-13-7-12-27(14-15-28)19(30)11-10-18(29)24-20-25-26-21(34-20)33-16-17-8-5-4-6-9-17/h4-6,8-9H,7,10-16H2,1-3H3,(H,24,25,29) |
| InChIKey | GUGVPVGYFUZGPS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|