C18H21NO5 — CID 3335950
8-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 3335950) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 8-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | 8-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 3335950 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 8-[[2-(2-hydroxyethyl)piperidin-1-yl]methyl]-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | O=c1cc(CN2CCCCC2CCO)c2cc3c(cc2o1)OCO3 |
| InChI | InChI=1S/C18H21NO5/c20-6-4-13-3-1-2-5-19(13)10-12-7-18(21)24-15-9-17-16(8-14(12)15)22-11-23-17/h7-9,13,20H,1-6,10-11H2 |
| InChIKey | CIABPXIENRRBNZ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|