C33H29N7O4S2 — CID 3336767
N-[[4-benzyl-5-[2-[3-(4-methylphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide (PubChem CID 3336767) has the molecular formula C33H29N7O4S2 and a molecular weight of 651.77 g/mol. Its IUPAC name is N-[[4-benzyl-5-[2-[3-(4-methylphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide.
| Compound Name | N-[[4-benzyl-5-[2-[3-(4-methylphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3336767 |
| Molecular Formula | C33H29N7O4S2 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.17 |
| IUPAC Name | N-[[4-benzyl-5-[2-[3-(4-methylphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]sulfanyl-1,2,4-triazol-3-yl]methyl]-4-nitrobenzamide |
| SMILES | Cc1ccc(C2CC(c3cccs3)=NN2C(=O)CSc2nnc(CNC(=O)c3ccc([N+](=O)[O-])cc3)n2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H29N7O4S2/c1-22-9-11-24(12-10-22)28-18-27(29-8-5-17-45-29)37-39(28)31(41)21-46-33-36-35-30(38(33)20-23-6-3-2-4-7-23)19-34-32(42)25-13-15-26(16-14-25)40(43)44/h2-17,28H,18-21H2,1H3,(H,34,42) |
| InChIKey | GLAUZBBRWOOLGV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 135.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|