C30H26N4O3 — CID 3339432
[5-(3-ethoxypropyl)-8-phenyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] benzoate (PubChem CID 3339432) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is [5-(3-ethoxypropyl)-8-phenyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] benzoate.
| Compound Name | [5-(3-ethoxypropyl)-8-phenyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] benzoate |
|---|---|
| PubChem CID | 3339432 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [5-(3-ethoxypropyl)-8-phenyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] benzoate |
| SMILES | CCOCCCn1cc(OC(=O)c2ccccc2)c2c1nc(-c1ccccc1)n1c3ccccc3nc21 |
| InChI | InChI=1S/C30H26N4O3/c1-2-36-19-11-18-33-20-25(37-30(35)22-14-7-4-8-15-22)26-28(33)32-27(21-12-5-3-6-13-21)34-24-17-10-9-16-23(24)31-29(26)34/h3-10,12-17,20H,2,11,18-19H2,1H3 |
| InChIKey | QHJNJKAMKDIREN-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|