C23H18N4O4 — CID 3731119
methyl 4-(3-acetyloxy-8-methyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-5-yl)benzoate (PubChem CID 3731119) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is methyl 4-(3-acetyloxy-8-methyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-5-yl)benzoate.
| Compound Name | methyl 4-(3-acetyloxy-8-methyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-5-yl)benzoate |
|---|---|
| PubChem CID | 3731119 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | methyl 4-(3-acetyloxy-8-methyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(-n2cc(OC(C)=O)c3c2nc(C)n2c4ccccc4nc32)cc1 |
| InChI | InChI=1S/C23H18N4O4/c1-13-24-21-20(22-25-17-6-4-5-7-18(17)27(13)22)19(31-14(2)28)12-26(21)16-10-8-15(9-11-16)23(29)30-3/h4-12H,1-3H3 |
| InChIKey | SHVRHYYJDOZRLK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |