C30H34N4O2 — CID 4893887
[5-(3-methylphenyl)-8-pentyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] hexanoate (PubChem CID 4893887) has the molecular formula C30H34N4O2 and a molecular weight of 482.63 g/mol. Its IUPAC name is [5-(3-methylphenyl)-8-pentyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] hexanoate.
| Compound Name | [5-(3-methylphenyl)-8-pentyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] hexanoate |
|---|---|
| PubChem CID | 4893887 |
| Molecular Formula | C30H34N4O2 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [5-(3-methylphenyl)-8-pentyl-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] hexanoate |
| SMILES | CCCCCC(=O)Oc1cn(-c2cccc(C)c2)c2nc(CCCCC)n3c4ccccc4nc3c12 |
| InChI | InChI=1S/C30H34N4O2/c1-4-6-8-17-26-32-29-28(30-31-23-15-10-11-16-24(23)34(26)30)25(36-27(35)18-9-7-5-2)20-33(29)22-14-12-13-21(3)19-22/h10-16,19-20H,4-9,17-18H2,1-3H3 |
| InChIKey | FLMKZHCWGBLQBO-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|