C29H32N4O2 — CID 4859430
[8-butyl-5-[(4-methylphenyl)methyl]-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] pentanoate (PubChem CID 4859430) has the molecular formula C29H32N4O2 and a molecular weight of 468.60 g/mol. Its IUPAC name is [8-butyl-5-[(4-methylphenyl)methyl]-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] pentanoate.
| Compound Name | [8-butyl-5-[(4-methylphenyl)methyl]-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] pentanoate |
|---|---|
| PubChem CID | 4859430 |
| Molecular Formula | C29H32N4O2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [8-butyl-5-[(4-methylphenyl)methyl]-5,7,9,16-tetrazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),3,7,10,12,14-heptaen-3-yl] pentanoate |
| SMILES | CCCCC(=O)Oc1cn(Cc2ccc(C)cc2)c2nc(CCCC)n3c4ccccc4nc3c12 |
| InChI | InChI=1S/C29H32N4O2/c1-4-6-12-25-31-28-27(29-30-22-10-8-9-11-23(22)33(25)29)24(35-26(34)13-7-5-2)19-32(28)18-21-16-14-20(3)15-17-21/h8-11,14-17,19H,4-7,12-13,18H2,1-3H3 |
| InChIKey | ULFWFCYGLFHSRI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |