C17H18N3O3S- — CID 3339967
N-[(C-phenyl-N-propan-2-ylcarbonimidoyl)sulfamoyl]benzenecarboximidate (PubChem CID 3339967) has the molecular formula C17H18N3O3S- and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[(C-phenyl-N-propan-2-ylcarbonimidoyl)sulfamoyl]benzenecarboximidate.
| Compound Name | N-[(C-phenyl-N-propan-2-ylcarbonimidoyl)sulfamoyl]benzenecarboximidate |
|---|---|
| PubChem CID | 3339967 |
| Molecular Formula | C17H18N3O3S- |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[(C-phenyl-N-propan-2-ylcarbonimidoyl)sulfamoyl]benzenecarboximidate |
| SMILES | CC(C)/N=C(/NS(=O)(=O)N=C([O-])c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19N3O3S/c1-13(2)18-16(14-9-5-3-6-10-14)19-24(22,23)20-17(21)15-11-7-4-8-12-15/h3-13H,1-2H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | BOCHRHSHNDXKTQ-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|