C27H22N2O3 — CID 3341173
[4-[4-[3-(2-cyanoethyl)-2-methylindolizine-1-carbonyl]phenyl]phenyl] acetate (PubChem CID 3341173) has the molecular formula C27H22N2O3 and a molecular weight of 422.48 g/mol. Its IUPAC name is [4-[4-[3-(2-cyanoethyl)-2-methylindolizine-1-carbonyl]phenyl]phenyl] acetate.
| Compound Name | [4-[4-[3-(2-cyanoethyl)-2-methylindolizine-1-carbonyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 3341173 |
| Molecular Formula | C27H22N2O3 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | [4-[4-[3-(2-cyanoethyl)-2-methylindolizine-1-carbonyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)c3c(C)c(CCC#N)n4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C27H22N2O3/c1-18-24(7-5-16-28)29-17-4-3-6-25(29)26(18)27(31)22-10-8-20(9-11-22)21-12-14-23(15-13-21)32-19(2)30/h3-4,6,8-15,17H,5,7H2,1-2H3 |
| InChIKey | QLBLPQVJSQAOLD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 71.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|