C20H18N2O — CID 7996342
3-[2-methyl-1-(2-methylbenzoyl)indolizin-3-yl]propanenitrile (PubChem CID 7996342) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[2-methyl-1-(2-methylbenzoyl)indolizin-3-yl]propanenitrile.
| Compound Name | 3-[2-methyl-1-(2-methylbenzoyl)indolizin-3-yl]propanenitrile |
|---|---|
| PubChem CID | 7996342 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 3-[2-methyl-1-(2-methylbenzoyl)indolizin-3-yl]propanenitrile |
| SMILES | Cc1ccccc1C(=O)c1c(C)c(CCC#N)n2ccccc12 |
| InChI | InChI=1S/C20H18N2O/c1-14-8-3-4-9-16(14)20(23)19-15(2)17(11-7-12-21)22-13-6-5-10-18(19)22/h3-6,8-10,13H,7,11H2,1-2H3 |
| InChIKey | PFJLIYYYNRVASW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 45.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |