C22H24ClN3O2S — CID 3341920
2-acetamido-3-(3-chloro-4-methylphenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]propanamide (PubChem CID 3341920) has the molecular formula C22H24ClN3O2S and a molecular weight of 429.97 g/mol. Its IUPAC name is 2-acetamido-3-(3-chloro-4-methylphenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]propanamide.
| Compound Name | 2-acetamido-3-(3-chloro-4-methylphenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 3341920 |
| Molecular Formula | C22H24ClN3O2S |
| Molecular Weight | 429.97 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 2-acetamido-3-(3-chloro-4-methylphenyl)sulfanyl-N-[2-(1H-indol-3-yl)ethyl]propanamide |
| SMILES | CC(=O)NC(CSc1ccc(C)c(Cl)c1)C(=O)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24ClN3O2S/c1-14-7-8-17(11-19(14)23)29-13-21(26-15(2)27)22(28)24-10-9-16-12-25-20-6-4-3-5-18(16)20/h3-8,11-12,21,25H,9-10,13H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | DABHHBSEOLXQFM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |