C15H17N3O5S2 — CID 3342372
ethyl 2-[[5-[2-(4-methylphenyl)sulfonylethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate (PubChem CID 3342372) has the molecular formula C15H17N3O5S2 and a molecular weight of 383.45 g/mol. Its IUPAC name is ethyl 2-[[5-[2-(4-methylphenyl)sulfonylethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate.
| Compound Name | ethyl 2-[[5-[2-(4-methylphenyl)sulfonylethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
|---|---|
| PubChem CID | 3342372 |
| Molecular Formula | C15H17N3O5S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | ethyl 2-[[5-[2-(4-methylphenyl)sulfonylethyl]-1,3,4-thiadiazol-2-yl]amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1nnc(CCS(=O)(=O)c2ccc(C)cc2)s1 |
| InChI | InChI=1S/C15H17N3O5S2/c1-3-23-14(20)13(19)16-15-18-17-12(24-15)8-9-25(21,22)11-6-4-10(2)5-7-11/h4-7H,3,8-9H2,1-2H3,(H,16,18,19) |
| InChIKey | OATKRRHCDJNRFS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|