C23H21BrCl2N2O5 — CID 3343363
8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3343363) has the molecular formula C23H21BrCl2N2O5 and a molecular weight of 556.24 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3343363 |
| Molecular Formula | C23H21BrCl2N2O5 |
| Molecular Weight | 556.24 g/mol |
| Exact Mass | 554.00 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)NC(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)cc(C)c1O |
| InChI | InChI=1S/C23H21BrCl2N2O5/c1-9-5-11(6-10(2)17(9)29)16-12-3-4-13-15(19(31)27-18(13)30)14(12)7-22(25)20(32)28(8-24)21(33)23(16,22)26/h3,5-6,13-16,29H,4,7-8H2,1-2H3,(H,27,30,31) |
| InChIKey | DUPIFQFHKBRTCX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|