C27H29BrCl2N2O5 — CID 4174630
8-(bromomethyl)-2-tert-butyl-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4174630) has the molecular formula C27H29BrCl2N2O5 and a molecular weight of 612.35 g/mol. Its IUPAC name is 8-(bromomethyl)-2-tert-butyl-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-2-tert-butyl-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4174630 |
| Molecular Formula | C27H29BrCl2N2O5 |
| Molecular Weight | 612.35 g/mol |
| Exact Mass | 610.06 |
| IUPAC Name | 8-(bromomethyl)-2-tert-butyl-6a,9a-dichloro-6-(4-hydroxy-3,5-dimethylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cc(C2C3=CCC4C(=O)N(C(C)(C)C)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)cc(C)c1O |
| InChI | InChI=1S/C27H29BrCl2N2O5/c1-12-8-14(9-13(2)20(12)33)19-15-6-7-16-18(22(35)32(21(16)34)25(3,4)5)17(15)10-26(29)23(36)31(11-28)24(37)27(19,26)30/h6,8-9,16-19,33H,7,10-11H2,1-5H3 |
| InChIKey | RZUSPLFWTBWWPZ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.35 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|