C32H43N3O5S — CID 3344023
2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 3344023) has the molecular formula C32H43N3O5S and a molecular weight of 581.78 g/mol. Its IUPAC name is 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 3344023 |
| Molecular Formula | C32H43N3O5S |
| Molecular Weight | 581.78 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(3-methoxypropyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COCCCNC(=O)c1c(NC(=O)CCCCCCCCCCN2C(=O)c3ccccc3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C32H43N3O5S/c1-40-22-14-20-33-29(37)28-25-17-11-12-18-26(25)41-30(28)34-27(36)19-8-6-4-2-3-5-7-13-21-35-31(38)23-15-9-10-16-24(23)32(35)39/h9-10,15-16H,2-8,11-14,17-22H2,1H3,(H,33,37)(H,34,36) |
| InChIKey | AYYNQMZWHNYOSP-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.78 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|