C33H38N4O4S — CID 3351011
2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide (PubChem CID 3351011) has the molecular formula C33H38N4O4S and a molecular weight of 586.76 g/mol. Its IUPAC name is 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide.
| Compound Name | 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 3351011 |
| Molecular Formula | C33H38N4O4S |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | 2-[11-(1,3-dioxoisoindol-2-yl)undecanoylamino]-N-(pyridin-3-ylmethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxamide |
| SMILES | O=C(CCCCCCCCCCN1C(=O)c2ccccc2C1=O)Nc1sc2c(c1C(=O)NCc1cccnc1)CCC2 |
| InChI | InChI=1S/C33H38N4O4S/c38-28(36-31-29(26-16-11-17-27(26)42-31)30(39)35-22-23-13-12-19-34-21-23)18-7-5-3-1-2-4-6-10-20-37-32(40)24-14-8-9-15-25(24)33(37)41/h8-9,12-15,19,21H,1-7,10-11,16-18,20,22H2,(H,35,39)(H,36,38) |
| InChIKey | JNRHAPAXAUQDIF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|