C19H20Cl2N2O2 — CID 3345532
N-(3,5-dichlorophenyl)-2-(oxolan-2-ylmethylamino)-2-phenylacetamide (PubChem CID 3345532) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-(oxolan-2-ylmethylamino)-2-phenylacetamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-(oxolan-2-ylmethylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 3345532 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-(oxolan-2-ylmethylamino)-2-phenylacetamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C(NCC1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H20Cl2N2O2/c20-14-9-15(21)11-16(10-14)23-19(24)18(13-5-2-1-3-6-13)22-12-17-7-4-8-25-17/h1-3,5-6,9-11,17-18,22H,4,7-8,12H2,(H,23,24) |
| InChIKey | LRRQTUSQZIUAFZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |