C20H27N3O3 — CID 3346252
2-methyl-5-(3-nitrophenyl)-1-octan-2-ylpyrrole-3-carboxamide (PubChem CID 3346252) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 2-methyl-5-(3-nitrophenyl)-1-octan-2-ylpyrrole-3-carboxamide.
| Compound Name | 2-methyl-5-(3-nitrophenyl)-1-octan-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3346252 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 2-methyl-5-(3-nitrophenyl)-1-octan-2-ylpyrrole-3-carboxamide |
| SMILES | CCCCCCC(C)n1c(-c2cccc([N+](=O)[O-])c2)cc(C(N)=O)c1C |
| InChI | InChI=1S/C20H27N3O3/c1-4-5-6-7-9-14(2)22-15(3)18(20(21)24)13-19(22)16-10-8-11-17(12-16)23(25)26/h8,10-14H,4-7,9H2,1-3H3,(H2,21,24) |
| InChIKey | ALPJCIJDGKGTIA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|