C21H15F6N3O3 — CID 3799937
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-5-(3-nitrophenyl)pyrrole-3-carboxamide (PubChem CID 3799937) has the molecular formula C21H15F6N3O3 and a molecular weight of 471.36 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-5-(3-nitrophenyl)pyrrole-3-carboxamide.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-5-(3-nitrophenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3799937 |
| Molecular Formula | C21H15F6N3O3 |
| Molecular Weight | 471.36 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-methyl-5-(3-nitrophenyl)pyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)cc(-c2cccc([N+](=O)[O-])c2)n1Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F6N3O3/c1-11-17(19(28)31)9-18(13-3-2-4-16(7-13)30(32)33)29(11)10-12-5-14(20(22,23)24)8-15(6-12)21(25,26)27/h2-9H,10H2,1H3,(H2,28,31) |
| InChIKey | UWPZNKVCBMEKRJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.36 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|