C17H19F3N2O — CID 3348125
2-methyl-1-(2-methylpropyl)-5-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 3348125) has the molecular formula C17H19F3N2O and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-methyl-1-(2-methylpropyl)-5-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2-methyl-1-(2-methylpropyl)-5-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3348125 |
| Molecular Formula | C17H19F3N2O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-methyl-1-(2-methylpropyl)-5-[4-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1c(C(N)=O)cc(-c2ccc(C(F)(F)F)cc2)n1CC(C)C |
| InChI | InChI=1S/C17H19F3N2O/c1-10(2)9-22-11(3)14(16(21)23)8-15(22)12-4-6-13(7-5-12)17(18,19)20/h4-8,10H,9H2,1-3H3,(H2,21,23) |
| InChIKey | NTYRUVZWQSCHEI-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |