C15H12F2N2O — CID 3853810
5-(3,4-difluorophenyl)-2-methyl-1-prop-2-ynylpyrrole-3-carboxamide (PubChem CID 3853810) has the molecular formula C15H12F2N2O and a molecular weight of 274.27 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-2-methyl-1-prop-2-ynylpyrrole-3-carboxamide.
| Compound Name | 5-(3,4-difluorophenyl)-2-methyl-1-prop-2-ynylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 3853810 |
| Molecular Formula | C15H12F2N2O |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-(3,4-difluorophenyl)-2-methyl-1-prop-2-ynylpyrrole-3-carboxamide |
| SMILES | C#CCn1c(-c2ccc(F)c(F)c2)cc(C(N)=O)c1C |
| InChI | InChI=1S/C15H12F2N2O/c1-3-6-19-9(2)11(15(18)20)8-14(19)10-4-5-12(16)13(17)7-10/h1,4-5,7-8H,6H2,2H3,(H2,18,20) |
| InChIKey | DQIOCHFVURAUBI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|