C18H19N3O5 — CID 33473943
propyl 4-[(4-carbamoyl-2-nitrophenyl)methylamino]benzoate (PubChem CID 33473943) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is propyl 4-[(4-carbamoyl-2-nitrophenyl)methylamino]benzoate.
| Compound Name | propyl 4-[(4-carbamoyl-2-nitrophenyl)methylamino]benzoate |
|---|---|
| PubChem CID | 33473943 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | propyl 4-[(4-carbamoyl-2-nitrophenyl)methylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NCc2ccc(C(N)=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H19N3O5/c1-2-9-26-18(23)12-5-7-15(8-6-12)20-11-14-4-3-13(17(19)22)10-16(14)21(24)25/h3-8,10,20H,2,9,11H2,1H3,(H2,19,22) |
| InChIKey | FOHUALCUIPTHRJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|