C16H24N4O5 — CID 33480288
1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]-3-(4-methoxy-2-nitrophenyl)urea (PubChem CID 33480288) has the molecular formula C16H24N4O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]-3-(4-methoxy-2-nitrophenyl)urea.
| Compound Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]-3-(4-methoxy-2-nitrophenyl)urea |
|---|---|
| PubChem CID | 33480288 |
| Molecular Formula | C16H24N4O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]ethyl]-3-(4-methoxy-2-nitrophenyl)urea |
| SMILES | COc1ccc(NC(=O)NCCN2C[C@H](C)O[C@@H](C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H24N4O5/c1-11-9-19(10-12(2)25-11)7-6-17-16(21)18-14-5-4-13(24-3)8-15(14)20(22)23/h4-5,8,11-12H,6-7,9-10H2,1-3H3,(H2,17,18,21)/t11-,12-/m0/s1 |
| InChIKey | FHFGNDVLBKHTGE-RYUDHWBXSA-N |
| XLogP | 1.83 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|