C19H22FN3O2S — CID 33482623
4-[(1S)-1-(2-cyano-3-fluoroanilino)ethyl]-N,N-diethylbenzenesulfonamide (PubChem CID 33482623) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 4-[(1S)-1-(2-cyano-3-fluoroanilino)ethyl]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[(1S)-1-(2-cyano-3-fluoroanilino)ethyl]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 33482623 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-[(1S)-1-(2-cyano-3-fluoroanilino)ethyl]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc([C@H](C)Nc2cccc(F)c2C#N)cc1 |
| InChI | InChI=1S/C19H22FN3O2S/c1-4-23(5-2)26(24,25)16-11-9-15(10-12-16)14(3)22-19-8-6-7-18(20)17(19)13-21/h6-12,14,22H,4-5H2,1-3H3/t14-/m0/s1 |
| InChIKey | OZMUGWJOZAKJAD-AWEZNQCLSA-N |
| XLogP | 3.90 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |