C15H24N2O4 — CID 33483504
2-[bis(2-methoxyethyl)amino]-N-(4-methoxyphenyl)acetamide (PubChem CID 33483504) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[bis(2-methoxyethyl)amino]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[bis(2-methoxyethyl)amino]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 33483504 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[bis(2-methoxyethyl)amino]-N-(4-methoxyphenyl)acetamide |
| SMILES | COCCN(CCOC)CC(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H24N2O4/c1-19-10-8-17(9-11-20-2)12-15(18)16-13-4-6-14(21-3)7-5-13/h4-7H,8-12H2,1-3H3,(H,16,18) |
| InChIKey | NNHVDWHMXJDGIR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |