C28H24Cl2N2O3S — CID 3349826
methyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 3349826) has the molecular formula C28H24Cl2N2O3S and a molecular weight of 539.48 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3349826 |
| Molecular Formula | C28H24Cl2N2O3S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | methyl 2-[[2-(3,4-dichlorophenyl)quinoline-4-carbonyl]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)c2cc(-c3ccc(Cl)c(Cl)c3)nc3ccccc23)sc2c1CCCCCC2 |
| InChI | InChI=1S/C28H24Cl2N2O3S/c1-35-28(34)25-18-9-4-2-3-5-11-24(18)36-27(25)32-26(33)19-15-23(16-12-13-20(29)21(30)14-16)31-22-10-7-6-8-17(19)22/h6-8,10,12-15H,2-5,9,11H2,1H3,(H,32,33) |
| InChIKey | OMADUWIUDPENEF-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |