C19H32NO+ — CID 3354538
6-methyl-3-phenyl-1-piperidin-1-ium-1-ylheptan-3-ol (PubChem CID 3354538) has the molecular formula C19H32NO+ and a molecular weight of 290.47 g/mol. Its IUPAC name is 6-methyl-3-phenyl-1-piperidin-1-ium-1-ylheptan-3-ol.
| Compound Name | 6-methyl-3-phenyl-1-piperidin-1-ium-1-ylheptan-3-ol |
|---|---|
| PubChem CID | 3354538 |
| Molecular Formula | C19H32NO+ |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 6-methyl-3-phenyl-1-piperidin-1-ium-1-ylheptan-3-ol |
| SMILES | CC(C)CCC(O)(CC[NH+]1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H31NO/c1-17(2)11-12-19(21,18-9-5-3-6-10-18)13-16-20-14-7-4-8-15-20/h3,5-6,9-10,17,21H,4,7-8,11-16H2,1-2H3/p+1 |
| InChIKey | FHTWNTKDXPHJFT-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |