C38H44F2N4S4Sn — CID 3361564
bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(2-fluorophenyl)methylideneamino]azanide);dibutyltin (PubChem CID 3361564) has the molecular formula C38H44F2N4S4Sn and a molecular weight of 841.77 g/mol. Its IUPAC name is bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(2-fluorophenyl)methylideneamino]azanide);dibutyltin.
| Compound Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(2-fluorophenyl)methylideneamino]azanide);dibutyltin |
|---|---|
| PubChem CID | 3361564 |
| Molecular Formula | C38H44F2N4S4Sn |
| Molecular Weight | 841.77 g/mol |
| Exact Mass | 842.14 |
| IUPAC Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(2-fluorophenyl)methylideneamino]azanide);dibutyltin |
| SMILES | CCCC[Sn]CCCC.[H]/[S+]=C(/[N-]N=Cc1ccccc1F)SCc1ccccc1.[H]/[S+]=C(/[N-]N=Cc1ccccc1F)SCc1ccccc1 |
| InChI | InChI=1S/2C15H13FN2S2.2C4H9.Sn/c2*16-14-9-5-4-8-13(14)10-17-18-15(19)20-11-12-6-2-1-3-7-12;2*1-3-4-2;/h2*1-10H,11H2,(H,18,19);2*1,3-4H2,2H3; |
| InChIKey | VQSLFEARKSRATR-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.77 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|