C32H30F2N4PdS4 — CID 5494237
bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(E)-1-(2-fluorophenyl)ethylideneamino]azanide);palladium (PubChem CID 5494237) has the molecular formula C32H30F2N4PdS4 and a molecular weight of 743.30 g/mol. Its IUPAC name is bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(E)-1-(2-fluorophenyl)ethylideneamino]azanide);palladium.
| Compound Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(E)-1-(2-fluorophenyl)ethylideneamino]azanide);palladium |
|---|---|
| PubChem CID | 5494237 |
| Molecular Formula | C32H30F2N4PdS4 |
| Molecular Weight | 743.30 g/mol |
| Exact Mass | 742.04 |
| IUPAC Name | bis([benzylsulfanyl(sulfoniumylidene)methyl]-[(E)-1-(2-fluorophenyl)ethylideneamino]azanide);palladium |
| SMILES | [H]/[S+]=C(/[N-]/N=C(/C)c1ccccc1F)SCc1ccccc1.[H]/[S+]=C(/[N-]/N=C(/C)c1ccccc1F)SCc1ccccc1.[Pd] |
| InChI | InChI=1S/2C16H15FN2S2.Pd/c2*1-12(14-9-5-6-10-15(14)17)18-19-16(20)21-11-13-7-3-2-4-8-13;/h2*2-10H,11H2,1H3,(H,19,20);/b2*18-12-; |
| InChIKey | WUSYYPZMWZCOIA-MGJDWUFUSA-N |
| XLogP | 8.44 |
| TPSA | 52.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.30 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|