C18H24N2O5 — CID 3364721
ethyl 4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonylamino)benzoate (PubChem CID 3364721) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is ethyl 4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonylamino)benzoate.
| Compound Name | ethyl 4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonylamino)benzoate |
|---|---|
| PubChem CID | 3364721 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | ethyl 4-(1,5-dioxa-9-azaspiro[5.5]undecane-9-carbonylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CCC3(CC2)OCCCO3)cc1 |
| InChI | InChI=1S/C18H24N2O5/c1-2-23-16(21)14-4-6-15(7-5-14)19-17(22)20-10-8-18(9-11-20)24-12-3-13-25-18/h4-7H,2-3,8-13H2,1H3,(H,19,22) |
| InChIKey | QHGUJHKGSHRODR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |