C18H25N3O3 — CID 95221832
ethyl 4-[[(5S)-2,9-diazaspiro[4.5]decane-2-carbonyl]amino]benzoate (PubChem CID 95221832) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is ethyl 4-[[(5S)-2,9-diazaspiro[4.5]decane-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[(5S)-2,9-diazaspiro[4.5]decane-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 95221832 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | ethyl 4-[[(5S)-2,9-diazaspiro[4.5]decane-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)N2CC[C@]3(CCCNC3)C2)cc1 |
| InChI | InChI=1S/C18H25N3O3/c1-2-24-16(22)14-4-6-15(7-5-14)20-17(23)21-11-9-18(13-21)8-3-10-19-12-18/h4-7,19H,2-3,8-13H2,1H3,(H,20,23)/t18-/m0/s1 |
| InChIKey | DJXIOMUBSWVAFL-SFHVURJKSA-N |
| XLogP | 2.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |