C20H25BrN5O2+ — CID 3365695
7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(4-methylpiperidin-1-yl)-9H-purin-7-ium-2,6-dione (PubChem CID 3365695) has the molecular formula C20H25BrN5O2+ and a molecular weight of 447.36 g/mol. Its IUPAC name is 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(4-methylpiperidin-1-yl)-9H-purin-7-ium-2,6-dione.
| Compound Name | 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(4-methylpiperidin-1-yl)-9H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 3365695 |
| Molecular Formula | C20H25BrN5O2+ |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 7-[(3-bromophenyl)methyl]-1,3-dimethyl-8-(4-methylpiperidin-1-yl)-9H-purin-7-ium-2,6-dione |
| SMILES | CC1CCN(c2[nH]c3c(c(=O)n(C)c(=O)n3C)[n+]2Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C20H24BrN5O2/c1-13-7-9-25(10-8-13)19-22-17-16(18(27)24(3)20(28)23(17)2)26(19)12-14-5-4-6-15(21)11-14/h4-6,11,13H,7-10,12H2,1-3H3/p+1 |
| InChIKey | FMKPHOXKODXVQN-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|