C23H20ClN3O5S — CID 3371330
4-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-N-(2-methoxyphenyl)-3-nitrobenzamide (PubChem CID 3371330) has the molecular formula C23H20ClN3O5S and a molecular weight of 485.95 g/mol. Its IUPAC name is 4-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-N-(2-methoxyphenyl)-3-nitrobenzamide.
| Compound Name | 4-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-N-(2-methoxyphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 3371330 |
| Molecular Formula | C23H20ClN3O5S |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.08 |
| IUPAC Name | 4-[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]sulfanyl-N-(2-methoxyphenyl)-3-nitrobenzamide |
| SMILES | COc1ccccc1NC(=O)c1ccc(SCC(=O)NCc2ccccc2Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H20ClN3O5S/c1-32-20-9-5-4-8-18(20)26-23(29)15-10-11-21(19(12-15)27(30)31)33-14-22(28)25-13-16-6-2-3-7-17(16)24/h2-12H,13-14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | YIJWDPNBUBIYSI-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|