C16H10F3N2O5S- — CID 3592651
2-[2-nitro-4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]sulfanylacetate (PubChem CID 3592651) has the molecular formula C16H10F3N2O5S- and a molecular weight of 399.33 g/mol. Its IUPAC name is 2-[2-nitro-4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]sulfanylacetate.
| Compound Name | 2-[2-nitro-4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 3592651 |
| Molecular Formula | C16H10F3N2O5S- |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-[2-nitro-4-[[2-(trifluoromethyl)phenyl]carbamoyl]phenyl]sulfanylacetate |
| SMILES | O=C([O-])CSc1ccc(C(=O)Nc2ccccc2C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11F3N2O5S/c17-16(18,19)10-3-1-2-4-11(10)20-15(24)9-5-6-13(27-8-14(22)23)12(7-9)21(25)26/h1-7H,8H2,(H,20,24)(H,22,23)/p-1 |
| InChIKey | MHWVYXODROSRKD-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|