C27H30N4O6 — CID 3373936
2-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(2,4-dimethoxyphenyl)methylideneamino]-3-phenylpropanamide (PubChem CID 3373936) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(2,4-dimethoxyphenyl)methylideneamino]-3-phenylpropanamide.
| Compound Name | 2-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(2,4-dimethoxyphenyl)methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 3373936 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)carbamoylamino]-N-[(2,4-dimethoxyphenyl)methylideneamino]-3-phenylpropanamide |
| SMILES | COc1ccc(C=NNC(=O)C(Cc2ccccc2)NC(=O)Nc2ccc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C27H30N4O6/c1-34-20-11-10-19(24(15-20)36-3)17-28-31-26(32)23(14-18-8-6-5-7-9-18)30-27(33)29-22-13-12-21(35-2)16-25(22)37-4/h5-13,15-17,23H,14H2,1-4H3,(H,31,32)(H2,29,30,33) |
| InChIKey | ZSHFDZHUUGOMJU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|