C27H22ClNO3 — CID 3385049
1-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 3385049) has the molecular formula C27H22ClNO3 and a molecular weight of 443.93 g/mol. Its IUPAC name is 1-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3385049 |
| Molecular Formula | C27H22ClNO3 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-(2,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)c2c(C)nc3ccc(Cl)cc3c2-c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C27H22ClNO3/c1-17-26(24(30)14-10-18-9-12-21(31-2)16-25(18)32-3)27(19-7-5-4-6-8-19)22-15-20(28)11-13-23(22)29-17/h4-16H,1-3H3 |
| InChIKey | TZRSXQYFWJBVNN-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|