C30H23ClN2O3 — CID 6149670
3-[(Z)-3-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-oxoprop-1-enyl]-7-ethoxy-1H-quinolin-2-one (PubChem CID 6149670) has the molecular formula C30H23ClN2O3 and a molecular weight of 494.98 g/mol. Its IUPAC name is 3-[(Z)-3-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-oxoprop-1-enyl]-7-ethoxy-1H-quinolin-2-one.
| Compound Name | 3-[(Z)-3-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-oxoprop-1-enyl]-7-ethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 6149670 |
| Molecular Formula | C30H23ClN2O3 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | 3-[(Z)-3-(6-chloro-2-methyl-4-phenylquinolin-3-yl)-3-oxoprop-1-enyl]-7-ethoxy-1H-quinolin-2-one |
| SMILES | CCOc1ccc2cc(/C=C\C(=O)c3c(C)nc4ccc(Cl)cc4c3-c3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C30H23ClN2O3/c1-3-36-23-12-9-20-15-21(30(35)33-26(20)17-23)10-14-27(34)28-18(2)32-25-13-11-22(31)16-24(25)29(28)19-7-5-4-6-8-19/h4-17H,3H2,1-2H3,(H,33,35)/b14-10- |
| InChIKey | OBGJLPGGQYVCGE-UVTDQMKNSA-N |
| XLogP | 7.00 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|